C7H11FO3 — CID 146398622
(1S,2R,3S)-4-(fluoromethyl)cyclohex-4-ene-1,2,3-triol (PubChem CID 146398622) has the molecular formula C7H11FO3 and a molecular weight of 162.16 g/mol. Its IUPAC name is (1S,2R,3S)-4-(fluoromethyl)cyclohex-4-ene-1,2,3-triol.
| Compound Name | (1S,2R,3S)-4-(fluoromethyl)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 146398622 |
| Molecular Formula | C7H11FO3 |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (1S,2R,3S)-4-(fluoromethyl)cyclohex-4-ene-1,2,3-triol |
| SMILES | O[C@@H]1[C@@H](O)CC=C(CF)[C@@H]1O |
| InChI | InChI=1S/C7H11FO3/c8-3-4-1-2-5(9)7(11)6(4)10/h1,5-7,9-11H,2-3H2/t5-,6-,7+/m0/s1 |
| InChIKey | MEBSLUGPALOYNO-LYFYHCNISA-N |
| XLogP | -0.63 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|