C22H31F3N4 — CID 146398781
N'-[(2E,4Z)-2-(methylideneamino)-3-(trifluoromethyl)hexa-2,4-dienyl]-N'-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]butane-1,4-diamine (PubChem CID 146398781) has the molecular formula C22H31F3N4 and a molecular weight of 408.51 g/mol. Its IUPAC name is N'-[(2E,4Z)-2-(methylideneamino)-3-(trifluoromethyl)hexa-2,4-dienyl]-N'-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]butane-1,4-diamine.
| Compound Name | N'-[(2E,4Z)-2-(methylideneamino)-3-(trifluoromethyl)hexa-2,4-dienyl]-N'-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 146398781 |
| Molecular Formula | C22H31F3N4 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | N'-[(2E,4Z)-2-(methylideneamino)-3-(trifluoromethyl)hexa-2,4-dienyl]-N'-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]butane-1,4-diamine |
| SMILES | C=N/C(CN(CCCCN)C[C@H]1Cc2ccccc2CN1)=C(\C=C/C)C(F)(F)F |
| InChI | InChI=1S/C22H31F3N4/c1-3-8-20(22(23,24)25)21(27-2)16-29(12-7-6-11-26)15-19-13-17-9-4-5-10-18(17)14-28-19/h3-5,8-10,19,28H,2,6-7,11-16,26H2,1H3/b8-3-,21-20+/t19-/m1/s1 |
| InChIKey | JWONREAPXQPXAK-DQLXKKKVSA-N |
| XLogP | 3.83 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|