C13H13N3 — CID 146399003
5-pyrimidin-4-yl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 146399003) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 5-pyrimidin-4-yl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 5-pyrimidin-4-yl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 146399003 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 5-pyrimidin-4-yl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1cc2c(c(-c3ccncn3)c1)CCNC2 |
| InChI | InChI=1S/C13H13N3/c1-2-10-8-14-6-4-11(10)12(3-1)13-5-7-15-9-16-13/h1-3,5,7,9,14H,4,6,8H2 |
| InChIKey | STPWTAQQCJIIGF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |