C13H16O5 — CID 146399166
(5E)-5-(furan-2-ylmethylidene)-7-hydroxy-2,2,6-trimethyl-1,3-dioxepan-4-one (PubChem CID 146399166) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is (5E)-5-(furan-2-ylmethylidene)-7-hydroxy-2,2,6-trimethyl-1,3-dioxepan-4-one.
| Compound Name | (5E)-5-(furan-2-ylmethylidene)-7-hydroxy-2,2,6-trimethyl-1,3-dioxepan-4-one |
|---|---|
| PubChem CID | 146399166 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (5E)-5-(furan-2-ylmethylidene)-7-hydroxy-2,2,6-trimethyl-1,3-dioxepan-4-one |
| SMILES | CC1/C(=C\c2ccco2)C(=O)OC(C)(C)OC1O |
| InChI | InChI=1S/C13H16O5/c1-8-10(7-9-5-4-6-16-9)12(15)18-13(2,3)17-11(8)14/h4-8,11,14H,1-3H3/b10-7+ |
| InChIKey | UVDYUXFIMVCDGG-JXMROGBWSA-N |
| XLogP | 1.93 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|