About 3-ethyl-7-fluoro-1,1-dimethyl-2,3-dihydroinden-4-amine
3-ethyl-7-fluoro-1,1-dimethyl-2,3-dihydroinden-4-amine (PubChem CID 146399440) has the molecular formula C13H18FN
and a molecular weight of 207.29 g/mol. Its IUPAC name is 3-ethyl-7-fluoro-1,1-dimethyl-2,3-dihydroinden-4-amine.
Molecular Properties
| Compound Name | 3-ethyl-7-fluoro-1,1-dimethyl-2,3-dihydroinden-4-amine |
| PubChem CID | 146399440 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3-ethyl-7-fluoro-1,1-dimethyl-2,3-dihydroinden-4-amine |
| SMILES | CCC1CC(C)(C)c2c(F)ccc(N)c21 |
| InChI | InChI=1S/C13H18FN/c1-4-8-7-13(2,3)12-9(14)5-6-10(15)11(8)12/h5-6,8H,4,7,15H2,1-3H3 |
| InChIKey | MNVCPWDCRPQUHD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-7-fluoro-1,1-dimethyl-2,3-dihydroinden-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-7-fluoro-1,1-dimethyl-2,3-dihydroinden-4-amine?
The IUPAC name of 3-ethyl-7-fluoro-1,1-dimethyl-2,3-dihydroinden-4-amine (CID 146399440) is 3-ethyl-7-fluoro-1,1-dimethyl-2,3-dihydroinden-4-amine.
What is the SMILES notation for 3-ethyl-7-fluoro-1,1-dimethyl-2,3-dihydroinden-4-amine?
The canonical SMILES for 3-ethyl-7-fluoro-1,1-dimethyl-2,3-dihydroinden-4-amine is CCC1CC(C)(C)c2c(F)ccc(N)c21.
What is the InChIKey of 3-ethyl-7-fluoro-1,1-dimethyl-2,3-dihydroinden-4-amine?
The InChIKey is MNVCPWDCRPQUHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FN/c1-4-8-7-13(2,3)12-9(14)5-6-10(15)11(8)12/h5-6,8H,4,7,15H2,1-3H3.
What are the key properties of 3-ethyl-7-fluoro-1,1-dimethyl-2,3-dihydroinden-4-amine?
3-ethyl-7-fluoro-1,1-dimethyl-2,3-dihydroinden-4-amine has a molecular weight of 207.29 g/mol, XLogP of 3.58, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-7-fluoro-1,1-dimethyl-2,3-dihydroinden-4-amine is sourced from PubChem (CID 146399440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).