C32H36F3N5O4S — CID 146399727
(3S)-3-[3-[(1,1-dioxo-5-pentyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-2-yl)methyl]-4-methylphenyl]-3-[8-methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]propanoic acid (PubChem CID 146399727) has the molecular formula C32H36F3N5O4S and a molecular weight of 643.73 g/mol. Its IUPAC name is (3S)-3-[3-[(1,1-dioxo-5-pentyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-2-yl)methyl]-4-methylphenyl]-3-[8-methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]propanoic acid.
| Compound Name | (3S)-3-[3-[(1,1-dioxo-5-pentyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-2-yl)methyl]-4-methylphenyl]-3-[8-methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]propanoic acid |
|---|---|
| PubChem CID | 146399727 |
| Molecular Formula | C32H36F3N5O4S |
| Molecular Weight | 643.73 g/mol |
| Exact Mass | 643.24 |
| IUPAC Name | (3S)-3-[3-[(1,1-dioxo-5-pentyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-2-yl)methyl]-4-methylphenyl]-3-[8-methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]propanoic acid |
| SMILES | CCCCCN1CCN(Cc2cc([C@H](CC(=O)O)c3ccn4c(C(F)(F)F)nnc4c3C)ccc2C)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C32H36F3N5O4S/c1-4-5-8-14-38-16-17-39(45(43,44)28-10-7-6-9-27(28)38)20-24-18-23(12-11-21(24)2)26(19-29(41)42)25-13-15-40-30(22(25)3)36-37-31(40)32(33,34)35/h6-7,9-13,15,18,26H,4-5,8,14,16-17,19-20H2,1-3H3,(H,41,42)/t26-/m0/s1 |
| InChIKey | PUCKZNRVQXVGNR-SANMLTNESA-N |
| XLogP | 6.17 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.73 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|