About 3-chloro-6-methyl-5-propyl-1,6-dihydropyridazine
3-chloro-6-methyl-5-propyl-1,6-dihydropyridazine (PubChem CID 146400022) has the molecular formula C8H13ClN2
and a molecular weight of 172.66 g/mol. Its IUPAC name is 3-chloro-6-methyl-5-propyl-1,6-dihydropyridazine.
Molecular Properties
| Compound Name | 3-chloro-6-methyl-5-propyl-1,6-dihydropyridazine |
| PubChem CID | 146400022 |
| Molecular Formula | C8H13ClN2 |
| Molecular Weight | 172.66 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 3-chloro-6-methyl-5-propyl-1,6-dihydropyridazine |
| SMILES | CCCC1=CC(Cl)=NNC1C |
| InChI | InChI=1S/C8H13ClN2/c1-3-4-7-5-8(9)11-10-6(7)2/h5-6,10H,3-4H2,1-2H3 |
| InChIKey | LTQSPUSBDQFANX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.66 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-6-methyl-5-propyl-1,6-dihydropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-methyl-5-propyl-1,6-dihydropyridazine?
The IUPAC name of 3-chloro-6-methyl-5-propyl-1,6-dihydropyridazine (CID 146400022) is 3-chloro-6-methyl-5-propyl-1,6-dihydropyridazine.
What is the SMILES notation for 3-chloro-6-methyl-5-propyl-1,6-dihydropyridazine?
The canonical SMILES for 3-chloro-6-methyl-5-propyl-1,6-dihydropyridazine is CCCC1=CC(Cl)=NNC1C.
What is the InChIKey of 3-chloro-6-methyl-5-propyl-1,6-dihydropyridazine?
The InChIKey is LTQSPUSBDQFANX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClN2/c1-3-4-7-5-8(9)11-10-6(7)2/h5-6,10H,3-4H2,1-2H3.
What are the key properties of 3-chloro-6-methyl-5-propyl-1,6-dihydropyridazine?
3-chloro-6-methyl-5-propyl-1,6-dihydropyridazine has a molecular weight of 172.66 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-methyl-5-propyl-1,6-dihydropyridazine is sourced from PubChem (CID 146400022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).