C23H32N8 — CID 146400692
N-[3-imino-2-[6-[(5-propan-2-ylpyridazin-3-yl)amino]-1,5-naphthyridin-3-yl]propyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 146400692) has the molecular formula C23H32N8 and a molecular weight of 420.57 g/mol. Its IUPAC name is N-[3-imino-2-[6-[(5-propan-2-ylpyridazin-3-yl)amino]-1,5-naphthyridin-3-yl]propyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[3-imino-2-[6-[(5-propan-2-ylpyridazin-3-yl)amino]-1,5-naphthyridin-3-yl]propyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 146400692 |
| Molecular Formula | C23H32N8 |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | N-[3-imino-2-[6-[(5-propan-2-ylpyridazin-3-yl)amino]-1,5-naphthyridin-3-yl]propyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | [H]/N=C/C(CNCCCN(C)C)c1cnc2ccc(Nc3cc(C(C)C)cnn3)nc2c1 |
| InChI | InChI=1S/C23H32N8/c1-16(2)17-11-23(30-27-15-17)29-22-7-6-20-21(28-22)10-18(14-26-20)19(12-24)13-25-8-5-9-31(3)4/h6-7,10-12,14-16,19,24-25H,5,8-9,13H2,1-4H3,(H,28,29,30)/b24-12+ |
| InChIKey | VWKWPKATTUPWJZ-WYMPLXKRSA-N |
| XLogP | 3.56 |
| TPSA | 102.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|