C16H16ClFN4 — CID 146400804
7-[1-butyl-3-(fluoromethyl)pyrazol-4-yl]-2-chloro-1,5-naphthyridine (PubChem CID 146400804) has the molecular formula C16H16ClFN4 and a molecular weight of 318.78 g/mol. Its IUPAC name is 7-[1-butyl-3-(fluoromethyl)pyrazol-4-yl]-2-chloro-1,5-naphthyridine.
| Compound Name | 7-[1-butyl-3-(fluoromethyl)pyrazol-4-yl]-2-chloro-1,5-naphthyridine |
|---|---|
| PubChem CID | 146400804 |
| Molecular Formula | C16H16ClFN4 |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 7-[1-butyl-3-(fluoromethyl)pyrazol-4-yl]-2-chloro-1,5-naphthyridine |
| SMILES | CCCCn1cc(-c2cnc3ccc(Cl)nc3c2)c(CF)n1 |
| InChI | InChI=1S/C16H16ClFN4/c1-2-3-6-22-10-12(15(8-18)21-22)11-7-14-13(19-9-11)4-5-16(17)20-14/h4-5,7,9-10H,2-3,6,8H2,1H3 |
| InChIKey | DQNWIBZLULMQCP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|