C18H22N2O5 — CID 146400999
ethyl 2-[(8'-hydroxy-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carbonyl)amino]acetate (PubChem CID 146400999) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is ethyl 2-[(8'-hydroxy-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carbonyl)amino]acetate.
| Compound Name | ethyl 2-[(8'-hydroxy-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 146400999 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | ethyl 2-[(8'-hydroxy-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carbonyl)amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C1=C(O)c2cccn2C2(CCCCC2)C1=O |
| InChI | InChI=1S/C18H22N2O5/c1-2-25-13(21)11-19-17(24)14-15(22)12-7-6-10-20(12)18(16(14)23)8-4-3-5-9-18/h6-7,10,22H,2-5,8-9,11H2,1H3,(H,19,24) |
| InChIKey | CPLGRNVBGVZVBP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|