C19H15F2N7O2S — CID 146401617
3-cyano-6-[3-(2,2-difluoroethyl)-5-[2-[(sulfinoamino)methyl]phenyl]imidazol-4-yl]imidazo[1,2-b]pyridazine (PubChem CID 146401617) has the molecular formula C19H15F2N7O2S and a molecular weight of 443.44 g/mol. Its IUPAC name is 3-cyano-6-[3-(2,2-difluoroethyl)-5-[2-[(sulfinoamino)methyl]phenyl]imidazol-4-yl]imidazo[1,2-b]pyridazine.
| Compound Name | 3-cyano-6-[3-(2,2-difluoroethyl)-5-[2-[(sulfinoamino)methyl]phenyl]imidazol-4-yl]imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 146401617 |
| Molecular Formula | C19H15F2N7O2S |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 3-cyano-6-[3-(2,2-difluoroethyl)-5-[2-[(sulfinoamino)methyl]phenyl]imidazol-4-yl]imidazo[1,2-b]pyridazine |
| SMILES | N#Cc1cnc2ccc(-c3c(-c4ccccc4CNS(=O)O)ncn3CC(F)F)nn12 |
| InChI | InChI=1S/C19H15F2N7O2S/c20-16(21)10-27-11-24-18(14-4-2-1-3-12(14)8-25-31(29)30)19(27)15-5-6-17-23-9-13(7-22)28(17)26-15/h1-6,9,11,16,25H,8,10H2,(H,29,30) |
| InChIKey | IQQWEDURRZDLKU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|