C37H44Cl2N2O10 — CID 146402786
2-[5-[2,5-dichloro-4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]pentanoyl-(2,3,4,5,6-pentahydroxyhexyl)amino]acetic acid (PubChem CID 146402786) has the molecular formula C37H44Cl2N2O10 and a molecular weight of 747.67 g/mol. Its IUPAC name is 2-[5-[2,5-dichloro-4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]pentanoyl-(2,3,4,5,6-pentahydroxyhexyl)amino]acetic acid.
| Compound Name | 2-[5-[2,5-dichloro-4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]pentanoyl-(2,3,4,5,6-pentahydroxyhexyl)amino]acetic acid |
|---|---|
| PubChem CID | 146402786 |
| Molecular Formula | C37H44Cl2N2O10 |
| Molecular Weight | 747.67 g/mol |
| Exact Mass | 746.24 |
| IUPAC Name | 2-[5-[2,5-dichloro-4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]pentanoyl-(2,3,4,5,6-pentahydroxyhexyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(O)C(O)C(O)C(O)CO)C(=O)CCCCc1cc(Cl)c(COC2(c3cnccc3-c3ccccc3OC3CC3)CC2)cc1Cl |
| InChI | InChI=1S/C37H44Cl2N2O10/c38-28-16-23(21-50-37(12-13-37)27-17-40-14-11-25(27)26-6-2-3-7-32(26)51-24-9-10-24)29(39)15-22(28)5-1-4-8-33(45)41(19-34(46)47)18-30(43)35(48)36(49)31(44)20-42/h2-3,6-7,11,14-17,24,30-31,35-36,42-44,48-49H,1,4-5,8-10,12-13,18-21H2,(H,46,47) |
| InChIKey | MNCVSRRQHGJUOI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 190.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.67 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|