C21H25F3N2O3 — CID 146403244
N-ethyl-N'-[5-methoxy-2-methyl-4-(1,1,1-trifluoro-2-hydroxy-3-phenoxypropan-2-yl)phenyl]-N-methylmethanimidamide (PubChem CID 146403244) has the molecular formula C21H25F3N2O3 and a molecular weight of 410.44 g/mol. Its IUPAC name is N-ethyl-N'-[5-methoxy-2-methyl-4-(1,1,1-trifluoro-2-hydroxy-3-phenoxypropan-2-yl)phenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[5-methoxy-2-methyl-4-(1,1,1-trifluoro-2-hydroxy-3-phenoxypropan-2-yl)phenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 146403244 |
| Molecular Formula | C21H25F3N2O3 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-ethyl-N'-[5-methoxy-2-methyl-4-(1,1,1-trifluoro-2-hydroxy-3-phenoxypropan-2-yl)phenyl]-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(OC)c(C(O)(COc2ccccc2)C(F)(F)F)cc1C |
| InChI | InChI=1S/C21H25F3N2O3/c1-5-26(3)14-25-18-12-19(28-4)17(11-15(18)2)20(27,21(22,23)24)13-29-16-9-7-6-8-10-16/h6-12,14,27H,5,13H2,1-4H3/b25-14+ |
| InChIKey | YDAGKBVPXMBQMC-AFUMVMLFSA-N |
| XLogP | 4.44 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|