C26H29ClN4O6 — CID 146403805
1-[2-chloro-4-[[5-(2-methoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-yl]oxy]phenyl]-3-cyclohexylurea (PubChem CID 146403805) has the molecular formula C26H29ClN4O6 and a molecular weight of 528.99 g/mol. Its IUPAC name is 1-[2-chloro-4-[[5-(2-methoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-yl]oxy]phenyl]-3-cyclohexylurea.
| Compound Name | 1-[2-chloro-4-[[5-(2-methoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-yl]oxy]phenyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 146403805 |
| Molecular Formula | C26H29ClN4O6 |
| Molecular Weight | 528.99 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 1-[2-chloro-4-[[5-(2-methoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinazolin-10-yl]oxy]phenyl]-3-cyclohexylurea |
| SMILES | COCCOc1cc2ncnc(Oc3ccc(NC(=O)NC4CCCCC4)c(Cl)c3)c2c2c1OCCO2 |
| InChI | InChI=1S/C26H29ClN4O6/c1-33-9-10-34-21-14-20-22(24-23(21)35-11-12-36-24)25(29-15-28-20)37-17-7-8-19(18(27)13-17)31-26(32)30-16-5-3-2-4-6-16/h7-8,13-16H,2-6,9-12H2,1H3,(H2,30,31,32) |
| InChIKey | UEWRNSKFVGXJPA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.99 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|