C24H19FN4O2 — CID 146404001
6-(3-amino-4-fluorophenyl)-8-benzyl-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol (PubChem CID 146404001) has the molecular formula C24H19FN4O2 and a molecular weight of 414.44 g/mol. Its IUPAC name is 6-(3-amino-4-fluorophenyl)-8-benzyl-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 6-(3-amino-4-fluorophenyl)-8-benzyl-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 146404001 |
| Molecular Formula | C24H19FN4O2 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 6-(3-amino-4-fluorophenyl)-8-benzyl-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
| SMILES | Nc1cc(-c2cn3c(O)c(Cc4ccco4)nc3c(Cc3ccccc3)n2)ccc1F |
| InChI | InChI=1S/C24H19FN4O2/c25-18-9-8-16(12-19(18)26)22-14-29-23(20(27-22)11-15-5-2-1-3-6-15)28-21(24(29)30)13-17-7-4-10-31-17/h1-10,12,14,30H,11,13,26H2 |
| InChIKey | FKBBXYDWKOGNKC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|