C25H22N4O2 — CID 146404026
6-(3-amino-2-methylphenyl)-8-benzyl-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol (PubChem CID 146404026) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 6-(3-amino-2-methylphenyl)-8-benzyl-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 6-(3-amino-2-methylphenyl)-8-benzyl-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 146404026 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 6-(3-amino-2-methylphenyl)-8-benzyl-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
| SMILES | Cc1c(N)cccc1-c1cn2c(O)c(Cc3ccco3)nc2c(Cc2ccccc2)n1 |
| InChI | InChI=1S/C25H22N4O2/c1-16-19(10-5-11-20(16)26)23-15-29-24(21(27-23)13-17-7-3-2-4-8-17)28-22(25(29)30)14-18-9-6-12-31-18/h2-12,15,30H,13-14,26H2,1H3 |
| InChIKey | PYQHWVRNMIIZEP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|