C20H26O6 — CID 146404408
(1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-yl) 4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate (PubChem CID 146404408) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is (1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-yl) 4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate.
| Compound Name | (1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-yl) 4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 146404408 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-yl) 4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate |
| SMILES | C=C(C)C1C=CC(C)(OC(=O)CC(=O)CC2=CC(=O)OC(C)(C)O2)CC1 |
| InChI | InChI=1S/C20H26O6/c1-13(2)14-6-8-20(5,9-7-14)26-17(22)11-15(21)10-16-12-18(23)25-19(3,4)24-16/h6,8,12,14H,1,7,9-11H2,2-5H3 |
| InChIKey | YAVKNPWDNCCPBR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|