C14H19BrN2O2S — CID 146404417
S-[[4-(2-aminoethylcarbamoyl)phenyl]methyl] 2-bromo-2-methylpropanethioate (PubChem CID 146404417) has the molecular formula C14H19BrN2O2S and a molecular weight of 359.29 g/mol. Its IUPAC name is S-[[4-(2-aminoethylcarbamoyl)phenyl]methyl] 2-bromo-2-methylpropanethioate.
| Compound Name | S-[[4-(2-aminoethylcarbamoyl)phenyl]methyl] 2-bromo-2-methylpropanethioate |
|---|---|
| PubChem CID | 146404417 |
| Molecular Formula | C14H19BrN2O2S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | S-[[4-(2-aminoethylcarbamoyl)phenyl]methyl] 2-bromo-2-methylpropanethioate |
| SMILES | CC(C)(Br)C(=O)SCc1ccc(C(=O)NCCN)cc1 |
| InChI | InChI=1S/C14H19BrN2O2S/c1-14(2,15)13(19)20-9-10-3-5-11(6-4-10)12(18)17-8-7-16/h3-6H,7-9,16H2,1-2H3,(H,17,18) |
| InChIKey | VUSYDSLWQHWXFP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|