C14H15ClFN5 — CID 146406333
N-[(1E,3E)-2-(4-chloro-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl)-4-fluoropenta-1,3-dienyl]methanimine (PubChem CID 146406333) has the molecular formula C14H15ClFN5 and a molecular weight of 307.76 g/mol. Its IUPAC name is N-[(1E,3E)-2-(4-chloro-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl)-4-fluoropenta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3E)-2-(4-chloro-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl)-4-fluoropenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 146406333 |
| Molecular Formula | C14H15ClFN5 |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[(1E,3E)-2-(4-chloro-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl)-4-fluoropenta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C(/C)F)c1nc(Cl)n2ncc(C(C)C)c2n1 |
| InChI | InChI=1S/C14H15ClFN5/c1-8(2)11-7-18-21-13(11)19-12(20-14(21)15)10(6-17-4)5-9(3)16/h5-8H,4H2,1-3H3/b9-5+,10-6+ |
| InChIKey | PSPGRPGJPLXDNJ-NXZHAISVSA-N |
| XLogP | 3.82 |
| TPSA | 55.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|