C24H23FO5 — CID 146406664
[(2R,3R,4R)-4-fluoro-5-methyl-3-[(E)-3-phenylprop-2-enoyl]oxyoxolan-2-yl]methyl (E)-3-phenylprop-2-enoate (PubChem CID 146406664) has the molecular formula C24H23FO5 and a molecular weight of 410.44 g/mol. Its IUPAC name is [(2R,3R,4R)-4-fluoro-5-methyl-3-[(E)-3-phenylprop-2-enoyl]oxyoxolan-2-yl]methyl (E)-3-phenylprop-2-enoate.
| Compound Name | [(2R,3R,4R)-4-fluoro-5-methyl-3-[(E)-3-phenylprop-2-enoyl]oxyoxolan-2-yl]methyl (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 146406664 |
| Molecular Formula | C24H23FO5 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [(2R,3R,4R)-4-fluoro-5-methyl-3-[(E)-3-phenylprop-2-enoyl]oxyoxolan-2-yl]methyl (E)-3-phenylprop-2-enoate |
| SMILES | CC1O[C@H](COC(=O)/C=C/c2ccccc2)[C@@H](OC(=O)/C=C/c2ccccc2)[C@@H]1F |
| InChI | InChI=1S/C24H23FO5/c1-17-23(25)24(30-22(27)15-13-19-10-6-3-7-11-19)20(29-17)16-28-21(26)14-12-18-8-4-2-5-9-18/h2-15,17,20,23-24H,16H2,1H3/b14-12+,15-13+/t17?,20-,23-,24-/m1/s1 |
| InChIKey | NTYPHDTZPNOWHJ-JQVWWWBQSA-N |
| XLogP | 3.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|