About [(2R,3S,4S)-4-fluoro-2-(methoxycarbonyloxymethyl)-5-methylthiolan-3-yl] methyl carbonate
[(2R,3S,4S)-4-fluoro-2-(methoxycarbonyloxymethyl)-5-methylthiolan-3-yl] methyl carbonate (PubChem CID 146406668) has the molecular formula C10H15FO6S
and a molecular weight of 282.29 g/mol. Its IUPAC name is [(2R,3S,4S)-4-fluoro-2-(methoxycarbonyloxymethyl)-5-methylthiolan-3-yl] methyl carbonate.
Molecular Properties
| Compound Name | [(2R,3S,4S)-4-fluoro-2-(methoxycarbonyloxymethyl)-5-methylthiolan-3-yl] methyl carbonate |
| PubChem CID | 146406668 |
| Molecular Formula | C10H15FO6S |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | [(2R,3S,4S)-4-fluoro-2-(methoxycarbonyloxymethyl)-5-methylthiolan-3-yl] methyl carbonate |
| SMILES | COC(=O)OC[C@H]1SC(C)[C@@H](F)[C@@H]1OC(=O)OC |
| InChI | InChI=1S/C10H15FO6S/c1-5-7(11)8(17-10(13)15-3)6(18-5)4-16-9(12)14-2/h5-8H,4H2,1-3H3/t5?,6-,7-,8-/m1/s1 |
| InChIKey | RLWQPYCXTYXTSU-UIYHXYAWSA-N |
| XLogP | 1.76 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(2R,3S,4S)-4-fluoro-2-(methoxycarbonyloxymethyl)-5-methylthiolan-3-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S,4S)-4-fluoro-2-(methoxycarbonyloxymethyl)-5-methylthiolan-3-yl] methyl carbonate?
The IUPAC name of [(2R,3S,4S)-4-fluoro-2-(methoxycarbonyloxymethyl)-5-methylthiolan-3-yl] methyl carbonate (CID 146406668) is [(2R,3S,4S)-4-fluoro-2-(methoxycarbonyloxymethyl)-5-methylthiolan-3-yl] methyl carbonate.
What is the SMILES notation for [(2R,3S,4S)-4-fluoro-2-(methoxycarbonyloxymethyl)-5-methylthiolan-3-yl] methyl carbonate?
The canonical SMILES for [(2R,3S,4S)-4-fluoro-2-(methoxycarbonyloxymethyl)-5-methylthiolan-3-yl] methyl carbonate is COC(=O)OC[C@H]1SC(C)[C@@H](F)[C@@H]1OC(=O)OC.
What is the InChIKey of [(2R,3S,4S)-4-fluoro-2-(methoxycarbonyloxymethyl)-5-methylthiolan-3-yl] methyl carbonate?
The InChIKey is RLWQPYCXTYXTSU-UIYHXYAWSA-N. The full InChI is InChI=1S/C10H15FO6S/c1-5-7(11)8(17-10(13)15-3)6(18-5)4-16-9(12)14-2/h5-8H,4H2,1-3H3/t5?,6-,7-,8-/m1/s1.
What are the key properties of [(2R,3S,4S)-4-fluoro-2-(methoxycarbonyloxymethyl)-5-methylthiolan-3-yl] methyl carbonate?
[(2R,3S,4S)-4-fluoro-2-(methoxycarbonyloxymethyl)-5-methylthiolan-3-yl] methyl carbonate has a molecular weight of 282.29 g/mol, XLogP of 1.76, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S,4S)-4-fluoro-2-(methoxycarbonyloxymethyl)-5-methylthiolan-3-yl] methyl carbonate is sourced from PubChem (CID 146406668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).