C23H23N5O2 — CID 146407067
(3S)-3-[[5-(3,3-dimethylcyclobutyl)-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 146407067) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is (3S)-3-[[5-(3,3-dimethylcyclobutyl)-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | (3S)-3-[[5-(3,3-dimethylcyclobutyl)-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 146407067 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | (3S)-3-[[5-(3,3-dimethylcyclobutyl)-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | CC1(C)CC(c2nnc(N[C@H]3N=C(c4ccccc4)c4ccccc4NC3=O)o2)C1 |
| InChI | InChI=1S/C23H23N5O2/c1-23(2)12-15(13-23)21-27-28-22(30-21)26-19-20(29)24-17-11-7-6-10-16(17)18(25-19)14-8-4-3-5-9-14/h3-11,15,19H,12-13H2,1-2H3,(H,24,29)(H,26,28)/t19-/m1/s1 |
| InChIKey | SCRYPTWKBIIZMO-LJQANCHMSA-N |
| XLogP | 4.20 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |