C21H26ClN7O3 — CID 146407143
5-[[(1Z,3E)-4-chloro-1-cyclobutyloxy-1-(methylideneamino)penta-1,3-dien-2-yl]amino]-7-(methylamino)-N-(oxetan-3-yl)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 146407143) has the molecular formula C21H26ClN7O3 and a molecular weight of 459.94 g/mol. Its IUPAC name is 5-[[(1Z,3E)-4-chloro-1-cyclobutyloxy-1-(methylideneamino)penta-1,3-dien-2-yl]amino]-7-(methylamino)-N-(oxetan-3-yl)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-[[(1Z,3E)-4-chloro-1-cyclobutyloxy-1-(methylideneamino)penta-1,3-dien-2-yl]amino]-7-(methylamino)-N-(oxetan-3-yl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 146407143 |
| Molecular Formula | C21H26ClN7O3 |
| Molecular Weight | 459.94 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 5-[[(1Z,3E)-4-chloro-1-cyclobutyloxy-1-(methylideneamino)penta-1,3-dien-2-yl]amino]-7-(methylamino)-N-(oxetan-3-yl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | C=N/C(OC1CCC1)=C(\C=C(/C)Cl)Nc1cc(NC)n2ncc(C(=O)NC3COC3)c2n1 |
| InChI | InChI=1S/C21H26ClN7O3/c1-12(22)7-16(21(24-3)32-14-5-4-6-14)27-17-8-18(23-2)29-19(28-17)15(9-25-29)20(30)26-13-10-31-11-13/h7-9,13-14,23H,3-6,10-11H2,1-2H3,(H,26,30)(H,27,28)/b12-7+,21-16- |
| InChIKey | ZSNHUFKHOMZWHM-CVNOZKGQSA-N |
| XLogP | 2.89 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.94 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|