About 5-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-N-methoxyisoquinolin-8-amine
5-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-N-methoxyisoquinolin-8-amine (PubChem CID 146407816) has the molecular formula C24H17FN4O
and a molecular weight of 396.43 g/mol. Its IUPAC name is 5-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-N-methoxyisoquinolin-8-amine.
Molecular Properties
| Compound Name | 5-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-N-methoxyisoquinolin-8-amine |
| PubChem CID | 146407816 |
| Molecular Formula | C24H17FN4O |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 5-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-N-methoxyisoquinolin-8-amine |
| SMILES | CONc1ccc(-c2cc(-c3ccccc3F)nc3ncccc23)c2ccncc12 |
| InChI | InChI=1S/C24H17FN4O/c1-30-29-22-9-8-15(16-10-12-26-14-20(16)22)19-13-23(18-5-2-3-7-21(18)25)28-24-17(19)6-4-11-27-24/h2-14,29H,1H3 |
| InChIKey | MRZGPHSHLZJCGV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-N-methoxyisoquinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-N-methoxyisoquinolin-8-amine?
The IUPAC name of 5-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-N-methoxyisoquinolin-8-amine (CID 146407816) is 5-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-N-methoxyisoquinolin-8-amine.
What is the SMILES notation for 5-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-N-methoxyisoquinolin-8-amine?
The canonical SMILES for 5-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-N-methoxyisoquinolin-8-amine is CONc1ccc(-c2cc(-c3ccccc3F)nc3ncccc23)c2ccncc12.
What is the InChIKey of 5-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-N-methoxyisoquinolin-8-amine?
The InChIKey is MRZGPHSHLZJCGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17FN4O/c1-30-29-22-9-8-15(16-10-12-26-14-20(16)22)19-13-23(18-5-2-3-7-21(18)25)28-24-17(19)6-4-11-27-24/h2-14,29H,1H3.
What are the key properties of 5-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-N-methoxyisoquinolin-8-amine?
5-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-N-methoxyisoquinolin-8-amine has a molecular weight of 396.43 g/mol, XLogP of 5.62, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-N-methoxyisoquinolin-8-amine is sourced from PubChem (CID 146407816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).