C26H36O7 — CID 146407862
[(1R,6S)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-[2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetyl]-3-oxooctanoate (PubChem CID 146407862) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is [(1R,6S)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-[2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetyl]-3-oxooctanoate.
| Compound Name | [(1R,6S)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-[2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetyl]-3-oxooctanoate |
|---|---|
| PubChem CID | 146407862 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | [(1R,6S)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-[2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetyl]-3-oxooctanoate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1OC(=O)C(C(=O)CCCCC)C(=O)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C26H36O7/c1-7-8-9-10-20(27)24(21(28)14-18-15-23(29)33-26(5,6)32-18)25(30)31-22-13-17(4)11-12-19(22)16(2)3/h13,15,19,22,24H,2,7-12,14H2,1,3-6H3/t19-,22+,24?/m0/s1 |
| InChIKey | LDIOYTNOGOUYLB-VBLFYTBKSA-N |
| XLogP | 4.75 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|