About [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-tris(trimethylsilyl)silane
[4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-tris(trimethylsilyl)silane (PubChem CID 14641000) has the molecular formula C23H48OSi5
and a molecular weight of 481.07 g/mol. Its IUPAC name is [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-tris(trimethylsilyl)silane.
Molecular Properties
| Compound Name | [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-tris(trimethylsilyl)silane |
| PubChem CID | 14641000 |
| Molecular Formula | C23H48OSi5 |
| Molecular Weight | 481.07 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-tris(trimethylsilyl)silane |
| SMILES | C[Si]1(C)OC(C23CC4CC(CC(C4)C2)C3)=C1[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C23H48OSi5/c1-25(2,3)29(26(4,5)6,27(7,8)9)22-21(24-28(22,10)11)23-15-18-12-19(16-23)14-20(13-18)17-23/h18-20H,12-17H2,1-11H3 |
| InChIKey | SRZCUBVKJWNKID-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.07 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-tris(trimethylsilyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-tris(trimethylsilyl)silane?
The IUPAC name of [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-tris(trimethylsilyl)silane (CID 14641000) is [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-tris(trimethylsilyl)silane.
What is the SMILES notation for [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-tris(trimethylsilyl)silane?
The canonical SMILES for [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-tris(trimethylsilyl)silane is C[Si]1(C)OC(C23CC4CC(CC(C4)C2)C3)=C1[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-tris(trimethylsilyl)silane?
The InChIKey is SRZCUBVKJWNKID-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H48OSi5/c1-25(2,3)29(26(4,5)6,27(7,8)9)22-21(24-28(22,10)11)23-15-18-12-19(16-23)14-20(13-18)17-23/h18-20H,12-17H2,1-11H3.
What are the key properties of [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-tris(trimethylsilyl)silane?
[4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-tris(trimethylsilyl)silane has a molecular weight of 481.07 g/mol, XLogP of 7.47, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1-adamantyl)-2,2-dimethyloxasilet-3-yl]-tris(trimethylsilyl)silane is sourced from PubChem (CID 14641000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).