C23H50O2Si5 — CID 14641002
2-(1-adamantyl)-2-[dimethyl-tris(trimethylsilyl)silylsilyl]acetic acid (PubChem CID 14641002) has the molecular formula C23H50O2Si5 and a molecular weight of 499.08 g/mol. Its IUPAC name is 2-(1-adamantyl)-2-[dimethyl-tris(trimethylsilyl)silylsilyl]acetic acid.
| Compound Name | 2-(1-adamantyl)-2-[dimethyl-tris(trimethylsilyl)silylsilyl]acetic acid |
|---|---|
| PubChem CID | 14641002 |
| Molecular Formula | C23H50O2Si5 |
| Molecular Weight | 499.08 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 2-(1-adamantyl)-2-[dimethyl-tris(trimethylsilyl)silylsilyl]acetic acid |
| SMILES | C[Si](C)(C)[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C(C(=O)O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H50O2Si5/c1-26(2,3)30(27(4,5)6,28(7,8)9)29(10,11)21(22(24)25)23-15-18-12-19(16-23)14-20(13-18)17-23/h18-21H,12-17H2,1-11H3,(H,24,25) |
| InChIKey | JQZJZFNHMQOZAC-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.08 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|