C24H32O7 — CID 146410128
[(1R,6S)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-[2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetyl]-3-oxohexanoate (PubChem CID 146410128) has the molecular formula C24H32O7 and a molecular weight of 432.51 g/mol. Its IUPAC name is [(1R,6S)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-[2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetyl]-3-oxohexanoate.
| Compound Name | [(1R,6S)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-[2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetyl]-3-oxohexanoate |
|---|---|
| PubChem CID | 146410128 |
| Molecular Formula | C24H32O7 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | [(1R,6S)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-[2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetyl]-3-oxohexanoate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1OC(=O)C(C(=O)CCC)C(=O)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C24H32O7/c1-7-8-18(25)22(19(26)12-16-13-21(27)31-24(5,6)30-16)23(28)29-20-11-15(4)9-10-17(20)14(2)3/h11,13,17,20,22H,2,7-10,12H2,1,3-6H3/t17-,20+,22?/m0/s1 |
| InChIKey | WHUPESHOAAQBPR-UNEGGNDLSA-N |
| XLogP | 3.97 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|