C20H28O6 — CID 146410129
[(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl] 4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate (PubChem CID 146410129) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is [(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl] 4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate.
| Compound Name | [(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl] 4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 146410129 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | [(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl] 4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate |
| SMILES | CC1=C[C@@H](OC(=O)CC(=O)CC2=CC(=O)OC(C)(C)O2)[C@H](C(C)C)CC1 |
| InChI | InChI=1S/C20H28O6/c1-12(2)16-7-6-13(3)8-17(16)24-18(22)10-14(21)9-15-11-19(23)26-20(4,5)25-15/h8,11-12,16-17H,6-7,9-10H2,1-5H3/t16-,17+/m0/s1 |
| InChIKey | RIVFKZVFCLZAPQ-DLBZAZTESA-N |
| XLogP | 3.45 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|