About 5-iodo-N,2,3-trimethylaniline
5-iodo-N,2,3-trimethylaniline (PubChem CID 146410922) has the molecular formula C9H12IN
and a molecular weight of 261.11 g/mol. Its IUPAC name is 5-iodo-N,2,3-trimethylaniline.
Molecular Properties
| Compound Name | 5-iodo-N,2,3-trimethylaniline |
| PubChem CID | 146410922 |
| Molecular Formula | C9H12IN |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 5-iodo-N,2,3-trimethylaniline |
| SMILES | CNc1cc(I)cc(C)c1C |
| InChI | InChI=1S/C9H12IN/c1-6-4-8(10)5-9(11-3)7(6)2/h4-5,11H,1-3H3 |
| InChIKey | JJPSROJRVUEIFX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-N,2,3-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-N,2,3-trimethylaniline?
The IUPAC name of 5-iodo-N,2,3-trimethylaniline (CID 146410922) is 5-iodo-N,2,3-trimethylaniline.
What is the SMILES notation for 5-iodo-N,2,3-trimethylaniline?
The canonical SMILES for 5-iodo-N,2,3-trimethylaniline is CNc1cc(I)cc(C)c1C.
What is the InChIKey of 5-iodo-N,2,3-trimethylaniline?
The InChIKey is JJPSROJRVUEIFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12IN/c1-6-4-8(10)5-9(11-3)7(6)2/h4-5,11H,1-3H3.
What are the key properties of 5-iodo-N,2,3-trimethylaniline?
5-iodo-N,2,3-trimethylaniline has a molecular weight of 261.11 g/mol, XLogP of 2.95, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-N,2,3-trimethylaniline is sourced from PubChem (CID 146410922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).