About (1-butan-2-yl-3,3-difluorocyclobutyl)-(3-fluoroazetidin-1-yl)methanone
(1-butan-2-yl-3,3-difluorocyclobutyl)-(3-fluoroazetidin-1-yl)methanone (PubChem CID 146411201) has the molecular formula C12H18F3NO
and a molecular weight of 249.28 g/mol. Its IUPAC name is (1-butan-2-yl-3,3-difluorocyclobutyl)-(3-fluoroazetidin-1-yl)methanone.
Molecular Properties
| Compound Name | (1-butan-2-yl-3,3-difluorocyclobutyl)-(3-fluoroazetidin-1-yl)methanone |
| PubChem CID | 146411201 |
| Molecular Formula | C12H18F3NO |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | (1-butan-2-yl-3,3-difluorocyclobutyl)-(3-fluoroazetidin-1-yl)methanone |
| SMILES | CCC(C)C1(C(=O)N2CC(F)C2)CC(F)(F)C1 |
| InChI | InChI=1S/C12H18F3NO/c1-3-8(2)11(6-12(14,15)7-11)10(17)16-4-9(13)5-16/h8-9H,3-7H2,1-2H3 |
| InChIKey | CDPSCZCYJKBUQB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1-butan-2-yl-3,3-difluorocyclobutyl)-(3-fluoroazetidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-butan-2-yl-3,3-difluorocyclobutyl)-(3-fluoroazetidin-1-yl)methanone?
The IUPAC name of (1-butan-2-yl-3,3-difluorocyclobutyl)-(3-fluoroazetidin-1-yl)methanone (CID 146411201) is (1-butan-2-yl-3,3-difluorocyclobutyl)-(3-fluoroazetidin-1-yl)methanone.
What is the SMILES notation for (1-butan-2-yl-3,3-difluorocyclobutyl)-(3-fluoroazetidin-1-yl)methanone?
The canonical SMILES for (1-butan-2-yl-3,3-difluorocyclobutyl)-(3-fluoroazetidin-1-yl)methanone is CCC(C)C1(C(=O)N2CC(F)C2)CC(F)(F)C1.
What is the InChIKey of (1-butan-2-yl-3,3-difluorocyclobutyl)-(3-fluoroazetidin-1-yl)methanone?
The InChIKey is CDPSCZCYJKBUQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F3NO/c1-3-8(2)11(6-12(14,15)7-11)10(17)16-4-9(13)5-16/h8-9H,3-7H2,1-2H3.
What are the key properties of (1-butan-2-yl-3,3-difluorocyclobutyl)-(3-fluoroazetidin-1-yl)methanone?
(1-butan-2-yl-3,3-difluorocyclobutyl)-(3-fluoroazetidin-1-yl)methanone has a molecular weight of 249.28 g/mol, XLogP of 2.63, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-butan-2-yl-3,3-difluorocyclobutyl)-(3-fluoroazetidin-1-yl)methanone is sourced from PubChem (CID 146411201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).