About dimethyl 6-methyl-5-oxobenzo[f][1,7]naphthyridine-2,3-dicarboxylate
dimethyl 6-methyl-5-oxobenzo[f][1,7]naphthyridine-2,3-dicarboxylate (PubChem CID 14641121) has the molecular formula C17H14N2O5
and a molecular weight of 326.31 g/mol. Its IUPAC name is dimethyl 6-methyl-5-oxobenzo[f][1,7]naphthyridine-2,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 6-methyl-5-oxobenzo[f][1,7]naphthyridine-2,3-dicarboxylate |
| PubChem CID | 14641121 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | dimethyl 6-methyl-5-oxobenzo[f][1,7]naphthyridine-2,3-dicarboxylate |
| SMILES | COC(=O)c1cc2c(nc1C(=O)OC)c(=O)n(C)c1ccccc21 |
| InChI | InChI=1S/C17H14N2O5/c1-19-12-7-5-4-6-9(12)10-8-11(16(21)23-2)14(17(22)24-3)18-13(10)15(19)20/h4-8H,1-3H3 |
| InChIKey | DJGSWIKTIJKUPC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 6-methyl-5-oxobenzo[f][1,7]naphthyridine-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 6-methyl-5-oxobenzo[f][1,7]naphthyridine-2,3-dicarboxylate?
The IUPAC name of dimethyl 6-methyl-5-oxobenzo[f][1,7]naphthyridine-2,3-dicarboxylate (CID 14641121) is dimethyl 6-methyl-5-oxobenzo[f][1,7]naphthyridine-2,3-dicarboxylate.
What is the SMILES notation for dimethyl 6-methyl-5-oxobenzo[f][1,7]naphthyridine-2,3-dicarboxylate?
The canonical SMILES for dimethyl 6-methyl-5-oxobenzo[f][1,7]naphthyridine-2,3-dicarboxylate is COC(=O)c1cc2c(nc1C(=O)OC)c(=O)n(C)c1ccccc21.
What is the InChIKey of dimethyl 6-methyl-5-oxobenzo[f][1,7]naphthyridine-2,3-dicarboxylate?
The InChIKey is DJGSWIKTIJKUPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O5/c1-19-12-7-5-4-6-9(12)10-8-11(16(21)23-2)14(17(22)24-3)18-13(10)15(19)20/h4-8H,1-3H3.
What are the key properties of dimethyl 6-methyl-5-oxobenzo[f][1,7]naphthyridine-2,3-dicarboxylate?
dimethyl 6-methyl-5-oxobenzo[f][1,7]naphthyridine-2,3-dicarboxylate has a molecular weight of 326.31 g/mol, XLogP of 1.66, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 6-methyl-5-oxobenzo[f][1,7]naphthyridine-2,3-dicarboxylate is sourced from PubChem (CID 14641121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).