C17H26N2O — CID 14641138
(E,2S)-2-benzyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]butan-1-imine (PubChem CID 14641138) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is (E,2S)-2-benzyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]butan-1-imine.
| Compound Name | (E,2S)-2-benzyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]butan-1-imine |
|---|---|
| PubChem CID | 14641138 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (E,2S)-2-benzyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]butan-1-imine |
| SMILES | CC[C@H](/C=N/N1CCC[C@H]1COC)Cc1ccccc1 |
| InChI | InChI=1S/C17H26N2O/c1-3-15(12-16-8-5-4-6-9-16)13-18-19-11-7-10-17(19)14-20-2/h4-6,8-9,13,15,17H,3,7,10-12,14H2,1-2H3/b18-13+/t15-,17-/m0/s1 |
| InChIKey | GTXTZZWRVLNIQM-VJOYDTAOSA-N |
| XLogP | 3.35 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|