C10H12IN3O2S — CID 146411393
methyl 2-(5-iodo-6-methylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-2-methylpropanoate (PubChem CID 146411393) has the molecular formula C10H12IN3O2S and a molecular weight of 365.20 g/mol. Its IUPAC name is methyl 2-(5-iodo-6-methylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-2-methylpropanoate.
| Compound Name | methyl 2-(5-iodo-6-methylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-2-methylpropanoate |
|---|---|
| PubChem CID | 146411393 |
| Molecular Formula | C10H12IN3O2S |
| Molecular Weight | 365.20 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | methyl 2-(5-iodo-6-methylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)c1nn2c(I)c(C)nc2s1 |
| InChI | InChI=1S/C10H12IN3O2S/c1-5-6(11)14-9(12-5)17-7(13-14)10(2,3)8(15)16-4/h1-4H3 |
| InChIKey | AJMYOSWCADGYTM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|