C8H8IN3S — CID 146411650
2-cyclopropyl-5-iodo-6-methylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 146411650) has the molecular formula C8H8IN3S and a molecular weight of 305.14 g/mol. Its IUPAC name is 2-cyclopropyl-5-iodo-6-methylimidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 2-cyclopropyl-5-iodo-6-methylimidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 146411650 |
| Molecular Formula | C8H8IN3S |
| Molecular Weight | 305.14 g/mol |
| Exact Mass | 304.95 |
| IUPAC Name | 2-cyclopropyl-5-iodo-6-methylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | Cc1nc2sc(C3CC3)nn2c1I |
| InChI | InChI=1S/C8H8IN3S/c1-4-6(9)12-8(10-4)13-7(11-12)5-2-3-5/h5H,2-3H2,1H3 |
| InChIKey | MRQHGQQSELDPGJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.14 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|