C24H33N5O5S2 — CID 146411680
2-[5-[3-[(4-hydroxycyclohexyl)sulfamoyl]-4-methoxyphenyl]-6-methylimidazo[2,1-b][1,3,4]thiadiazol-2-yl]-N,N,2-trimethylpropanamide (PubChem CID 146411680) has the molecular formula C24H33N5O5S2 and a molecular weight of 535.69 g/mol. Its IUPAC name is 2-[5-[3-[(4-hydroxycyclohexyl)sulfamoyl]-4-methoxyphenyl]-6-methylimidazo[2,1-b][1,3,4]thiadiazol-2-yl]-N,N,2-trimethylpropanamide.
| Compound Name | 2-[5-[3-[(4-hydroxycyclohexyl)sulfamoyl]-4-methoxyphenyl]-6-methylimidazo[2,1-b][1,3,4]thiadiazol-2-yl]-N,N,2-trimethylpropanamide |
|---|---|
| PubChem CID | 146411680 |
| Molecular Formula | C24H33N5O5S2 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | 2-[5-[3-[(4-hydroxycyclohexyl)sulfamoyl]-4-methoxyphenyl]-6-methylimidazo[2,1-b][1,3,4]thiadiazol-2-yl]-N,N,2-trimethylpropanamide |
| SMILES | COc1ccc(-c2c(C)nc3sc(C(C)(C)C(=O)N(C)C)nn23)cc1S(=O)(=O)NC1CCC(O)CC1 |
| InChI | InChI=1S/C24H33N5O5S2/c1-14-20(29-23(25-14)35-21(26-29)24(2,3)22(31)28(4)5)15-7-12-18(34-6)19(13-15)36(32,33)27-16-8-10-17(30)11-9-16/h7,12-13,16-17,27,30H,8-11H2,1-6H3 |
| InChIKey | RYOGNRGLQSUUGV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |