3-(2,4-dimethylpentan-3-ylideneamino)oxypropanoic acid

C10H19NO3 — CID 14641200

IUPAC3-(2,4-dimethylpentan-3-ylideneamino)oxypropanoic acid
SMILESCC(C)C(=NOCCC(=O)O)C(C)C
InChIInChI=1S/C10H19NO3/c1-7(2)10(8(3)4)11-14-6-5-9(12)13/h7-8H,5-6H2,1-4H3,(H,12,13)
InChIKeyHTLPUOZLWXSSFA-UHFFFAOYSA-N
MW201.27 g/mol
LogP2.15
Rot. Bonds6

About 3-(2,4-dimethylpentan-3-ylideneamino)oxypropanoic acid

3-(2,4-dimethylpentan-3-ylideneamino)oxypropanoic acid (PubChem CID 14641200) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-(2,4-dimethylpentan-3-ylideneamino)oxypropanoic acid.

Molecular Properties

Compound Name3-(2,4-dimethylpentan-3-ylideneamino)oxypropanoic acid
PubChem CID14641200
Molecular FormulaC10H19NO3
Molecular Weight201.27 g/mol
Exact Mass201.14
IUPAC Name3-(2,4-dimethylpentan-3-ylideneamino)oxypropanoic acid
SMILESCC(C)C(=NOCCC(=O)O)C(C)C
InChIInChI=1S/C10H19NO3/c1-7(2)10(8(3)4)11-14-6-5-9(12)13/h7-8H,5-6H2,1-4H3,(H,12,13)
InChIKeyHTLPUOZLWXSSFA-UHFFFAOYSA-N
XLogP2.15
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.27
LogP ≤ 52.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-(2,4-dimethylpentan-3-ylideneamino)oxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,4-dimethylpentan-3-ylideneamino)oxypropanoic acid?
The IUPAC name of 3-(2,4-dimethylpentan-3-ylideneamino)oxypropanoic acid (CID 14641200) is 3-(2,4-dimethylpentan-3-ylideneamino)oxypropanoic acid.
What is the SMILES notation for 3-(2,4-dimethylpentan-3-ylideneamino)oxypropanoic acid?
The canonical SMILES for 3-(2,4-dimethylpentan-3-ylideneamino)oxypropanoic acid is CC(C)C(=NOCCC(=O)O)C(C)C.
What is the InChIKey of 3-(2,4-dimethylpentan-3-ylideneamino)oxypropanoic acid?
The InChIKey is HTLPUOZLWXSSFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-7(2)10(8(3)4)11-14-6-5-9(12)13/h7-8H,5-6H2,1-4H3,(H,12,13).
What are the key properties of 3-(2,4-dimethylpentan-3-ylideneamino)oxypropanoic acid?
3-(2,4-dimethylpentan-3-ylideneamino)oxypropanoic acid has a molecular weight of 201.27 g/mol, XLogP of 2.15, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethylpentan-3-ylideneamino)oxypropanoic acid is sourced from PubChem (CID 14641200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).