C44H36F6O9S2 — CID 146412007
[5-[1,3-bis[[3-(2-methoxyphenyl)-2-oxothiochromen-7-yl]oxy]propan-2-yloxy]-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate (PubChem CID 146412007) has the molecular formula C44H36F6O9S2 and a molecular weight of 886.89 g/mol. Its IUPAC name is [5-[1,3-bis[[3-(2-methoxyphenyl)-2-oxothiochromen-7-yl]oxy]propan-2-yloxy]-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate.
| Compound Name | [5-[1,3-bis[[3-(2-methoxyphenyl)-2-oxothiochromen-7-yl]oxy]propan-2-yloxy]-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146412007 |
| Molecular Formula | C44H36F6O9S2 |
| Molecular Weight | 886.89 g/mol |
| Exact Mass | 886.17 |
| IUPAC Name | [5-[1,3-bis[[3-(2-methoxyphenyl)-2-oxothiochromen-7-yl]oxy]propan-2-yloxy]-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)COC(COc1ccc2cc(-c3ccccc3OC)c(=O)sc2c1)COc1ccc2cc(-c3ccccc3OC)c(=O)sc2c1 |
| InChI | InChI=1S/C44H36F6O9S2/c1-25(2)39(51)59-24-43(47,48)44(49,50)42(45,46)23-58-30(21-56-28-15-13-26-17-33(40(52)60-37(26)19-28)31-9-5-7-11-35(31)54-3)22-57-29-16-14-27-18-34(41(53)61-38(27)20-29)32-10-6-8-12-36(32)55-4/h5-20,30H,1,21-24H2,2-4H3 |
| InChIKey | DEFYJYBRRALGPO-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.89 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|