C47H37F9O11 — CID 146412062
[3-[1,3-bis[[3-[4-methyl-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxy]propan-2-yloxy]-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate (PubChem CID 146412062) has the molecular formula C47H37F9O11 and a molecular weight of 948.78 g/mol. Its IUPAC name is [3-[1,3-bis[[3-[4-methyl-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxy]propan-2-yloxy]-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate.
| Compound Name | [3-[1,3-bis[[3-[4-methyl-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxy]propan-2-yloxy]-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146412062 |
| Molecular Formula | C47H37F9O11 |
| Molecular Weight | 948.78 g/mol |
| Exact Mass | 948.22 |
| IUPAC Name | [3-[1,3-bis[[3-[4-methyl-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxy]propan-2-yloxy]-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC(OC(COc2ccc3cc(-c4ccc(C)cc4OC(F)(F)F)c(=O)oc3c2)COc2ccc3cc(-c4ccc(C)cc4OC(F)(F)F)c(=O)oc3c2)C1C(F)(F)F |
| InChI | InChI=1S/C47H37F9O11/c1-23(2)42(57)63-36-14-13-35(41(36)45(48,49)50)62-30(21-60-28-9-7-26-17-33(43(58)64-37(26)19-28)31-11-5-24(3)15-39(31)66-46(51,52)53)22-61-29-10-8-27-18-34(44(59)65-38(27)20-29)32-12-6-25(4)16-40(32)67-47(54,55)56/h5-12,15-20,30,35-36,41H,1,13-14,21-22H2,2-4H3 |
| InChIKey | KYDLVBNQGBSGKS-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 132.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.78 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|