C46H40F8O8 — CID 146412065
7-[2-(7-ethenoxy-4,4-difluoroheptoxy)-3-[3-[4-methyl-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]oxypropoxy]-3-[4-methyl-2-(trifluoromethyl)phenyl]chromen-2-one (PubChem CID 146412065) has the molecular formula C46H40F8O8 and a molecular weight of 872.80 g/mol. Its IUPAC name is 7-[2-(7-ethenoxy-4,4-difluoroheptoxy)-3-[3-[4-methyl-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]oxypropoxy]-3-[4-methyl-2-(trifluoromethyl)phenyl]chromen-2-one.
| Compound Name | 7-[2-(7-ethenoxy-4,4-difluoroheptoxy)-3-[3-[4-methyl-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]oxypropoxy]-3-[4-methyl-2-(trifluoromethyl)phenyl]chromen-2-one |
|---|---|
| PubChem CID | 146412065 |
| Molecular Formula | C46H40F8O8 |
| Molecular Weight | 872.80 g/mol |
| Exact Mass | 872.26 |
| IUPAC Name | 7-[2-(7-ethenoxy-4,4-difluoroheptoxy)-3-[3-[4-methyl-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]oxypropoxy]-3-[4-methyl-2-(trifluoromethyl)phenyl]chromen-2-one |
| SMILES | C=COCCCC(F)(F)CCCOC(COc1ccc2cc(-c3ccc(C)cc3C(F)(F)F)c(=O)oc2c1)COc1ccc2cc(-c3ccc(C)cc3C(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C46H40F8O8/c1-4-57-17-5-15-44(47,48)16-6-18-58-33(25-59-31-11-9-29-21-36(42(55)61-40(29)23-31)34-13-7-27(2)19-38(34)45(49,50)51)26-60-32-12-10-30-22-37(43(56)62-41(30)24-32)35-14-8-28(3)20-39(35)46(52,53)54/h4,7-14,19-24,33H,1,5-6,15-18,25-26H2,2-3H3 |
| InChIKey | NMYCZMWAKUQUSJ-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 97.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.80 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|