C47H52F2N2O7 — CID 146412071
[7-[1,3-bis[[2-(2-methoxy-4-methylphenyl)-1-methylindol-6-yl]oxy]propan-2-yloxy]-4,4-difluoroheptyl] prop-2-enoate (PubChem CID 146412071) has the molecular formula C47H52F2N2O7 and a molecular weight of 794.94 g/mol. Its IUPAC name is [7-[1,3-bis[[2-(2-methoxy-4-methylphenyl)-1-methylindol-6-yl]oxy]propan-2-yloxy]-4,4-difluoroheptyl] prop-2-enoate.
| Compound Name | [7-[1,3-bis[[2-(2-methoxy-4-methylphenyl)-1-methylindol-6-yl]oxy]propan-2-yloxy]-4,4-difluoroheptyl] prop-2-enoate |
|---|---|
| PubChem CID | 146412071 |
| Molecular Formula | C47H52F2N2O7 |
| Molecular Weight | 794.94 g/mol |
| Exact Mass | 794.37 |
| IUPAC Name | [7-[1,3-bis[[2-(2-methoxy-4-methylphenyl)-1-methylindol-6-yl]oxy]propan-2-yloxy]-4,4-difluoroheptyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCC(F)(F)CCCOC(COc1ccc2cc(-c3ccc(C)cc3OC)n(C)c2c1)COc1ccc2cc(-c3ccc(C)cc3OC)n(C)c2c1 |
| InChI | InChI=1S/C47H52F2N2O7/c1-8-46(52)56-22-10-20-47(48,49)19-9-21-55-37(29-57-35-15-13-33-25-42(50(4)40(33)27-35)38-17-11-31(2)23-44(38)53-6)30-58-36-16-14-34-26-43(51(5)41(34)28-36)39-18-12-32(3)24-45(39)54-7/h8,11-18,23-28,37H,1,9-10,19-22,29-30H2,2-7H3 |
| InChIKey | BGLLFYXUDCPLIZ-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 82.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.94 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|