About O-methyl N-[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioate
O-methyl N-[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioate (PubChem CID 146412124) has the molecular formula C8H15N5OS2
and a molecular weight of 261.38 g/mol. Its IUPAC name is O-methyl N-[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioate.
Molecular Properties
| Compound Name | O-methyl N-[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioate |
| PubChem CID | 146412124 |
| Molecular Formula | C8H15N5OS2 |
| Molecular Weight | 261.38 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | O-methyl N-[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioate |
| SMILES | CNC(=S)N/N=C(C)/C(C)=N/NC(=S)OC |
| InChI | InChI=1S/C8H15N5OS2/c1-5(10-12-7(15)9-3)6(2)11-13-8(16)14-4/h1-4H3,(H,13,16)(H2,9,12,15)/b10-5+,11-6+ |
| InChIKey | WPEFPLFYWHBTLE-YOYBCKCWSA-N |
| XLogP | 0.35 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.38 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-methyl N-[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl N-[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioate?
The IUPAC name of O-methyl N-[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioate (CID 146412124) is O-methyl N-[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioate.
What is the SMILES notation for O-methyl N-[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioate?
The canonical SMILES for O-methyl N-[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioate is CNC(=S)N/N=C(C)/C(C)=N/NC(=S)OC.
What is the InChIKey of O-methyl N-[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioate?
The InChIKey is WPEFPLFYWHBTLE-YOYBCKCWSA-N. The full InChI is InChI=1S/C8H15N5OS2/c1-5(10-12-7(15)9-3)6(2)11-13-8(16)14-4/h1-4H3,(H,13,16)(H2,9,12,15)/b10-5+,11-6+.
What are the key properties of O-methyl N-[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioate?
O-methyl N-[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioate has a molecular weight of 261.38 g/mol, XLogP of 0.35, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl N-[(E)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]carbamothioate is sourced from PubChem (CID 146412124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).