About 4-[4-(1-methyl-1,2,4-triazol-3-yl)but-1-en-2-yl]piperidine
4-[4-(1-methyl-1,2,4-triazol-3-yl)but-1-en-2-yl]piperidine (PubChem CID 146412189) has the molecular formula C12H20N4
and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-[4-(1-methyl-1,2,4-triazol-3-yl)but-1-en-2-yl]piperidine.
Molecular Properties
| Compound Name | 4-[4-(1-methyl-1,2,4-triazol-3-yl)but-1-en-2-yl]piperidine |
| PubChem CID | 146412189 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 4-[4-(1-methyl-1,2,4-triazol-3-yl)but-1-en-2-yl]piperidine |
| SMILES | C=C(CCc1ncn(C)n1)C1CCNCC1 |
| InChI | InChI=1S/C12H20N4/c1-10(11-5-7-13-8-6-11)3-4-12-14-9-16(2)15-12/h9,11,13H,1,3-8H2,2H3 |
| InChIKey | MNUMQGXCOIHXNG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(1-methyl-1,2,4-triazol-3-yl)but-1-en-2-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(1-methyl-1,2,4-triazol-3-yl)but-1-en-2-yl]piperidine?
The IUPAC name of 4-[4-(1-methyl-1,2,4-triazol-3-yl)but-1-en-2-yl]piperidine (CID 146412189) is 4-[4-(1-methyl-1,2,4-triazol-3-yl)but-1-en-2-yl]piperidine.
What is the SMILES notation for 4-[4-(1-methyl-1,2,4-triazol-3-yl)but-1-en-2-yl]piperidine?
The canonical SMILES for 4-[4-(1-methyl-1,2,4-triazol-3-yl)but-1-en-2-yl]piperidine is C=C(CCc1ncn(C)n1)C1CCNCC1.
What is the InChIKey of 4-[4-(1-methyl-1,2,4-triazol-3-yl)but-1-en-2-yl]piperidine?
The InChIKey is MNUMQGXCOIHXNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4/c1-10(11-5-7-13-8-6-11)3-4-12-14-9-16(2)15-12/h9,11,13H,1,3-8H2,2H3.
What are the key properties of 4-[4-(1-methyl-1,2,4-triazol-3-yl)but-1-en-2-yl]piperidine?
4-[4-(1-methyl-1,2,4-triazol-3-yl)but-1-en-2-yl]piperidine has a molecular weight of 220.32 g/mol, XLogP of 1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(1-methyl-1,2,4-triazol-3-yl)but-1-en-2-yl]piperidine is sourced from PubChem (CID 146412189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).