C30H30Cl2FN9O3 — CID 146412371
N-[3-[[4-(2,6-dichloro-3,5-dimethoxyphenyl)-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]amino]-1-(1-ethylpiperidin-4-yl)pyrazol-4-yl]-2-fluoroprop-2-enamide (PubChem CID 146412371) has the molecular formula C30H30Cl2FN9O3 and a molecular weight of 654.53 g/mol. Its IUPAC name is N-[3-[[4-(2,6-dichloro-3,5-dimethoxyphenyl)-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]amino]-1-(1-ethylpiperidin-4-yl)pyrazol-4-yl]-2-fluoroprop-2-enamide.
| Compound Name | N-[3-[[4-(2,6-dichloro-3,5-dimethoxyphenyl)-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]amino]-1-(1-ethylpiperidin-4-yl)pyrazol-4-yl]-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 146412371 |
| Molecular Formula | C30H30Cl2FN9O3 |
| Molecular Weight | 654.53 g/mol |
| Exact Mass | 653.18 |
| IUPAC Name | N-[3-[[4-(2,6-dichloro-3,5-dimethoxyphenyl)-[1,2,4]triazolo[1,5-a][1,6]naphthyridin-8-yl]amino]-1-(1-ethylpiperidin-4-yl)pyrazol-4-yl]-2-fluoroprop-2-enamide |
| SMILES | C=C(F)C(=O)Nc1cn(C2CCN(CC)CC2)nc1Nc1cc2c(cn1)cc(-c1c(Cl)c(OC)cc(OC)c1Cl)c1ncnn12 |
| InChI | InChI=1S/C30H30Cl2FN9O3/c1-5-40-8-6-18(7-9-40)41-14-20(37-30(43)16(2)33)28(39-41)38-24-11-21-17(13-34-24)10-19(29-35-15-36-42(21)29)25-26(31)22(44-3)12-23(45-4)27(25)32/h10-15,18H,2,5-9H2,1,3-4H3,(H,37,43)(H,34,38,39) |
| InChIKey | OXKTVNXNDKYSII-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.53 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|