C22H27N5O — CID 146412385
2-[4-amino-3-(6-methylpyridine-3-carboximidoyl)phenyl]-7-ethyl-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 146412385) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-[4-amino-3-(6-methylpyridine-3-carboximidoyl)phenyl]-7-ethyl-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | 2-[4-amino-3-(6-methylpyridine-3-carboximidoyl)phenyl]-7-ethyl-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 146412385 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 2-[4-amino-3-(6-methylpyridine-3-carboximidoyl)phenyl]-7-ethyl-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | [H]/N=C(\c1ccc(C)nc1)c1cc(N2CCC3(CCN(CC)C3)C2=O)ccc1N |
| InChI | InChI=1S/C22H27N5O/c1-3-26-10-8-22(14-26)9-11-27(21(22)28)17-6-7-19(23)18(12-17)20(24)16-5-4-15(2)25-13-16/h4-7,12-13,24H,3,8-11,14,23H2,1-2H3/b24-20+ |
| InChIKey | WBVANSJBIVASRP-HIXSDJFHSA-N |
| XLogP | 2.84 |
| TPSA | 86.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|