C17H15F2N5O2S — CID 146412505
N-[[8-(2,6-difluoro-3,5-dimethoxyphenyl)-5-(methylamino)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methylidene]methanethioamide (PubChem CID 146412505) has the molecular formula C17H15F2N5O2S and a molecular weight of 391.40 g/mol. Its IUPAC name is N-[[8-(2,6-difluoro-3,5-dimethoxyphenyl)-5-(methylamino)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methylidene]methanethioamide.
| Compound Name | N-[[8-(2,6-difluoro-3,5-dimethoxyphenyl)-5-(methylamino)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methylidene]methanethioamide |
|---|---|
| PubChem CID | 146412505 |
| Molecular Formula | C17H15F2N5O2S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | N-[[8-(2,6-difluoro-3,5-dimethoxyphenyl)-5-(methylamino)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methylidene]methanethioamide |
| SMILES | CNc1c(/C=N/C=S)cc(-c2c(F)c(OC)cc(OC)c2F)c2ncnn12 |
| InChI | InChI=1S/C17H15F2N5O2S/c1-20-16-9(6-21-8-27)4-10(17-22-7-23-24(16)17)13-14(18)11(25-2)5-12(26-3)15(13)19/h4-8,20H,1-3H3/b21-6+ |
| InChIKey | GNFCWFRQZWBHJW-AERZKKPOSA-N |
| XLogP | 3.11 |
| TPSA | 73.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|