C21H24N4O2S2 — CID 146412611
N-[7-[(1R)-1-(1,3-benzothiazol-5-yl)ethyl]-5,6,8,9-tetrahydropyrido[2,3-d]azepin-3-yl]cyclopropanesulfonamide (PubChem CID 146412611) has the molecular formula C21H24N4O2S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-[7-[(1R)-1-(1,3-benzothiazol-5-yl)ethyl]-5,6,8,9-tetrahydropyrido[2,3-d]azepin-3-yl]cyclopropanesulfonamide.
| Compound Name | N-[7-[(1R)-1-(1,3-benzothiazol-5-yl)ethyl]-5,6,8,9-tetrahydropyrido[2,3-d]azepin-3-yl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 146412611 |
| Molecular Formula | C21H24N4O2S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-[7-[(1R)-1-(1,3-benzothiazol-5-yl)ethyl]-5,6,8,9-tetrahydropyrido[2,3-d]azepin-3-yl]cyclopropanesulfonamide |
| SMILES | C[C@H](c1ccc2scnc2c1)N1CCc2cc(NS(=O)(=O)C3CC3)cnc2CC1 |
| InChI | InChI=1S/C21H24N4O2S2/c1-14(15-2-5-21-20(11-15)23-13-28-21)25-8-6-16-10-17(12-22-19(16)7-9-25)24-29(26,27)18-3-4-18/h2,5,10-14,18,24H,3-4,6-9H2,1H3/t14-/m1/s1 |
| InChIKey | DFGPLDTYINAJRW-CQSZACIVSA-N |
| XLogP | 3.76 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |