C16H24N2O9 — CID 146412931
[5-acetamido-3,4-diacetyloxy-6-(ethenylamino)oxyoxan-2-yl]methyl acetate (PubChem CID 146412931) has the molecular formula C16H24N2O9 and a molecular weight of 388.37 g/mol. Its IUPAC name is [5-acetamido-3,4-diacetyloxy-6-(ethenylamino)oxyoxan-2-yl]methyl acetate.
| Compound Name | [5-acetamido-3,4-diacetyloxy-6-(ethenylamino)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 146412931 |
| Molecular Formula | C16H24N2O9 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | [5-acetamido-3,4-diacetyloxy-6-(ethenylamino)oxyoxan-2-yl]methyl acetate |
| SMILES | C=CNOC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1NC(C)=O |
| InChI | InChI=1S/C16H24N2O9/c1-6-17-27-16-13(18-8(2)19)15(25-11(5)22)14(24-10(4)21)12(26-16)7-23-9(3)20/h6,12-17H,1,7H2,2-5H3,(H,18,19) |
| InChIKey | HYOCLNSUEGZOPV-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|