C29H35N5O5S — CID 146413170
3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[5-methyl-6-[(1-oxospiro[3H-5,1λ4,2-benzoxathiazepine-4,3'-oxetane]-2-yl)methyl]-2-pyridinyl]propanoic acid (PubChem CID 146413170) has the molecular formula C29H35N5O5S and a molecular weight of 565.70 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[5-methyl-6-[(1-oxospiro[3H-5,1λ4,2-benzoxathiazepine-4,3'-oxetane]-2-yl)methyl]-2-pyridinyl]propanoic acid.
| Compound Name | 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[5-methyl-6-[(1-oxospiro[3H-5,1λ4,2-benzoxathiazepine-4,3'-oxetane]-2-yl)methyl]-2-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 146413170 |
| Molecular Formula | C29H35N5O5S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[5-methyl-6-[(1-oxospiro[3H-5,1λ4,2-benzoxathiazepine-4,3'-oxetane]-2-yl)methyl]-2-pyridinyl]propanoic acid |
| SMILES | CCN(N)c1ccc(C(CC(=O)O)c2ccc(C)c(CN3CC4(COC4)Oc4ccccc4S3=O)n2)c(C)c1N |
| InChI | InChI=1S/C29H35N5O5S/c1-4-34(31)24-12-10-20(19(3)28(24)30)21(13-27(35)36)22-11-9-18(2)23(32-22)14-33-15-29(16-38-17-29)39-25-7-5-6-8-26(25)40(33)37/h5-12,21H,4,13-17,30-31H2,1-3H3,(H,35,36) |
| InChIKey | RHKSDIYISRJBBT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|