C29H27F3N6O4S — CID 146413372
3-[4-cyano-3-[(8-methyl-1-oxospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepine-4,1'-cyclopropane]-2-yl)methyl]phenyl]-3-[2-imino-3-methyl-1-(2,2,2-trifluoroethanimidoyl)-4-pyridinyl]propanoic acid (PubChem CID 146413372) has the molecular formula C29H27F3N6O4S and a molecular weight of 612.63 g/mol. Its IUPAC name is 3-[4-cyano-3-[(8-methyl-1-oxospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepine-4,1'-cyclopropane]-2-yl)methyl]phenyl]-3-[2-imino-3-methyl-1-(2,2,2-trifluoroethanimidoyl)-4-pyridinyl]propanoic acid.
| Compound Name | 3-[4-cyano-3-[(8-methyl-1-oxospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepine-4,1'-cyclopropane]-2-yl)methyl]phenyl]-3-[2-imino-3-methyl-1-(2,2,2-trifluoroethanimidoyl)-4-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 146413372 |
| Molecular Formula | C29H27F3N6O4S |
| Molecular Weight | 612.63 g/mol |
| Exact Mass | 612.18 |
| IUPAC Name | 3-[4-cyano-3-[(8-methyl-1-oxospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepine-4,1'-cyclopropane]-2-yl)methyl]phenyl]-3-[2-imino-3-methyl-1-(2,2,2-trifluoroethanimidoyl)-4-pyridinyl]propanoic acid |
| SMILES | [H]/N=C(/n1ccc(C(CC(=O)O)c2ccc(C#N)c(CN3CC4(CC4)Oc4ncc(C)cc4S3=O)c2)c(C)/c1=N\[H])C(F)(F)F |
| InChI | InChI=1S/C29H27F3N6O4S/c1-16-9-23-26(36-13-16)42-28(6-7-28)15-37(43(23)41)14-20-10-18(3-4-19(20)12-33)22(11-24(39)40)21-5-8-38(25(34)17(21)2)27(35)29(30,31)32/h3-5,8-10,13,22,34-35H,6-7,11,14-15H2,1-2H3,(H,39,40)/b34-25+,35-27+ |
| InChIKey | WZSSIJTTYPMQCU-UDRKUPDBSA-N |
| XLogP | 4.30 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.63 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|